Products 1260950-82-0

CAS 1260950-82-0 is the registry number for 1-(3,4-Dimethylphenyl)-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(3,4-dimethylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid (CAS 1260950-82-0) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid. InChIKey: UKMMKWZEHOJQBV-UHFFFAOYSA-N.

Identity
Molecular formulaC16H15N3O2
Molecular weight281.31 g/mol
IUPAC name1-(3,4-dimethylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid
InChIKeyUKMMKWZEHOJQBV-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)N2C(=C(C=N2)C(=O)O)N3C=CC=C3)C

Computed by PubChem (NCBI)