CAS 1260950-82-0 is the registry number for 1-(3,4-Dimethylphenyl)-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-(3,4-dimethylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid (CAS 1260950-82-0) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: 1-(3,4-dimethylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid. InChIKey: UKMMKWZEHOJQBV-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 1-(3,4-dimethylphenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid |
| InChIKey | UKMMKWZEHOJQBV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N2C(=C(C=N2)C(=O)O)N3C=CC=C3)C |
Computed by PubChem (NCBI)