CAS 1845690-61-0 is the registry number for Ethyl 1-benzyl-1,2,3-benzotriazole-5-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Ethyl 1-benzylbenzotriazole-5-carboxylate (CAS 1845690-61-0) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: ethyl 1-benzylbenzotriazole-5-carboxylate. InChIKey: HSPZQORGBVHTIG-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | ethyl 1-benzylbenzotriazole-5-carboxylate |
| InChIKey | HSPZQORGBVHTIG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)N(N=N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)