CAS 937598-72-6 is the registry number for 1,3-Dimethyl-6-(4-methylphenyl)-1H-pyrazolo(3,4-b)pyridine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
1,3-dimethyl-6-(4-methylphenyl)pyrazolo[5,4-b]pyridine-4-carboxylic acid (CAS 937598-72-6) is a chemical compound with the molecular formula C16H15N3O2 and a molecular weight of 281.31 g/mol. IUPAC name: 1,3-dimethyl-6-(4-methylphenyl)pyrazolo[5,4-b]pyridine-4-carboxylic acid. InChIKey: RZTGEBONDAJNFI-UHFFFAOYSA-N.
| Molecular formula | C16H15N3O2 |
|---|---|
| Molecular weight | 281.31 g/mol |
| IUPAC name | 1,3-dimethyl-6-(4-methylphenyl)pyrazolo[5,4-b]pyridine-4-carboxylic acid |
| InChIKey | RZTGEBONDAJNFI-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC3=C(C(=NN3C)C)C(=C2)C(=O)O |
Computed by PubChem (NCBI)