CAS 1176282-86-2 appears in our catalog under these names: 4-(2,2,2-Trifluoroethyl)benzoic acid, 4-(2,2,2-Trifluoroethyl)benzoic acid 95%, 4-(2,2,2-TRIFLUOROETHYL)BENZOIC ACID, 95%. Offered by: Biosynth, Ambeed, Fluorochem. Available pack sizes: 50mg, 0,5g, 100mg, 250mg, 1g, 5g.
4-(2,2,2-trifluoroethyl)benzoic acid (CAS 1176282-86-2) is a chemical compound with the molecular formula C9H7F3O2 and a molecular weight of 204.15 g/mol. IUPAC name: 4-(2,2,2-trifluoroethyl)benzoic acid. InChIKey: VQFXVWBKGITFDC-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O2 |
|---|---|
| Molecular weight | 204.15 g/mol |
| IUPAC name | 4-(2,2,2-trifluoroethyl)benzoic acid |
| InChIKey | VQFXVWBKGITFDC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)