Products 1176505-26-2
CAS 1176505-26-2 appears in our catalog under these names: 3-(1,3,4-Oxadiazol-2-yl)benzoic acid, 3-(1,3,4-Oxadiazol-2-yl)benzoic acid, 95%, 3-(1,3,4-Oxadiazol-2-yl)benzoic acid 95%, 3-[1,3,4]Oxadiazol-2-ylbenzoic acid, 95%, 95%. Offered by: Biosynth, Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 0,5g, 5g, 1g, 10g, 250mg, 100mg.
3-(1,3,4-oxadiazol-2-yl)benzoic acid (CAS 1176505-26-2) is a chemical compound with the molecular formula C9H6N2O3 and a molecular weight of 190.16 g/mol. IUPAC name: 3-(1,3,4-oxadiazol-2-yl)benzoic acid. InChIKey: MJPAHMZEXVECGY-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O3 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 3-(1,3,4-oxadiazol-2-yl)benzoic acid |
| InChIKey | MJPAHMZEXVECGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NN=CO2 |
Computed by PubChem (NCBI)