Products 1176582-38-9
CAS 1176582-38-9 appears in our catalog under these names: 1-(3-Methoxyphenyl)-3,5-dimethyl-1h-pyrazole-4-carboxylic acid, 95%, 1-(3-Methoxyphenyl)-3,5-dimethyl-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(3-methoxyphenyl)-3,5-dimethylpyrazole-4-carboxylic acid (CAS 1176582-38-9) is a chemical compound with the molecular formula C13H14N2O3 and a molecular weight of 246.26 g/mol. IUPAC name: 1-(3-methoxyphenyl)-3,5-dimethylpyrazole-4-carboxylic acid. InChIKey: UXHVSLDNCXPFRB-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O3 |
|---|---|
| Molecular weight | 246.26 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-3,5-dimethylpyrazole-4-carboxylic acid |
| InChIKey | UXHVSLDNCXPFRB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC(=CC=C2)OC)C)C(=O)O |
Computed by PubChem (NCBI)