CAS 1644667-51-5 is the registry number for 4-((2S,4S)-1-((Benzyloxy)carbonyl)-4-methoxypiperidin-2-yl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(2S,4S)-4-methoxy-1-phenylmethoxycarbonylpiperidin-2-yl]benzoic acid (CAS 1644667-51-5) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: 4-[(2S,4S)-4-methoxy-1-phenylmethoxycarbonylpiperidin-2-yl]benzoic acid. InChIKey: DYEKYPFKWVMVJV-OALUTQOASA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-[(2S,4S)-4-methoxy-1-phenylmethoxycarbonylpiperidin-2-yl]benzoic acid |
| InChIKey | DYEKYPFKWVMVJV-OALUTQOASA-N |
| SMILES | CO[C@H]1CCN([C@@H](C1)C2=CC=C(C=C2)C(=O)O)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)