CAS 1217833-77-6 is the registry number for Fmoc-(2r,3s)-2-amino-3-hydroxy-4-methylpentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-4-methylpentanoic acid (CAS 1217833-77-6) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-4-methylpentanoic acid. InChIKey: LYRGLIQVUMAZJU-MOPGFXCFSA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | (2R,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-4-methylpentanoic acid |
| InChIKey | LYRGLIQVUMAZJU-MOPGFXCFSA-N |
| SMILES | CC(C)[C@@H]([C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)O |
Computed by PubChem (NCBI)