CAS 1176702-57-0 is the registry number for 2-(2-Chloro-6-fluorophenyl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-(2-chloro-6-fluorophenyl)-2-methylpropanoic acid (CAS 1176702-57-0) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-2-methylpropanoic acid. InChIKey: FSCJUPKYKKZCPL-UHFFFAOYSA-N.
| Molecular formula | C10H10ClFO2 |
|---|---|
| Molecular weight | 216.63 g/mol |
| IUPAC name | 2-(2-chloro-6-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | FSCJUPKYKKZCPL-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC=C1Cl)F)C(=O)O |
Computed by PubChem (NCBI)