Products 1176702-57-0

CAS 1176702-57-0 is the registry number for 2-(2-Chloro-6-fluorophenyl)-2-methylpropanoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.

Structural formula: {0} (CAS {1})

2-(2-chloro-6-fluorophenyl)-2-methylpropanoic acid (CAS 1176702-57-0) is a chemical compound with the molecular formula C10H10ClFO2 and a molecular weight of 216.63 g/mol. IUPAC name: 2-(2-chloro-6-fluorophenyl)-2-methylpropanoic acid. InChIKey: FSCJUPKYKKZCPL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClFO2
Molecular weight216.63 g/mol
IUPAC name2-(2-chloro-6-fluorophenyl)-2-methylpropanoic acid
InChIKeyFSCJUPKYKKZCPL-UHFFFAOYSA-N
SMILESCC(C)(C1=C(C=CC=C1Cl)F)C(=O)O

Computed by PubChem (NCBI)