CAS 117693-90-0 is the registry number for Methyl 5-(bromomethyl)-1-phenyl-1h-1,2,3-triazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 5-(bromomethyl)-1-phenyltriazole-4-carboxylate (CAS 117693-90-0) is a chemical compound with the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. IUPAC name: methyl 5-(bromomethyl)-1-phenyltriazole-4-carboxylate. InChIKey: VNJRBOXRQLZOKG-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O2 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | methyl 5-(bromomethyl)-1-phenyltriazole-4-carboxylate |
| InChIKey | VNJRBOXRQLZOKG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N(N=N1)C2=CC=CC=C2)CBr |
Computed by PubChem (NCBI)