CAS 41604-61-9 is the registry number for 1-Benzyl-5-bromo-2-methyl-4-nitro-1h-imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 5g, 1g.
1-benzyl-5-bromo-2-methyl-4-nitroimidazole (CAS 41604-61-9) is a chemical compound with the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. IUPAC name: 1-benzyl-5-bromo-2-methyl-4-nitroimidazole. InChIKey: QYNZGJLWUKHLGP-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O2 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 1-benzyl-5-bromo-2-methyl-4-nitroimidazole |
| InChIKey | QYNZGJLWUKHLGP-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(N1CC2=CC=CC=C2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)