CAS 2279124-40-0 is the registry number for Methyl 1-benzyl-5-bromo-1h-1,2,4-triazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 1-benzyl-5-bromo-1,2,4-triazole-3-carboxylate (CAS 2279124-40-0) is a chemical compound with the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. IUPAC name: methyl 1-benzyl-5-bromo-1,2,4-triazole-3-carboxylate. InChIKey: YPTVHRTZSHUZTQ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O2 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | methyl 1-benzyl-5-bromo-1,2,4-triazole-3-carboxylate |
| InChIKey | YPTVHRTZSHUZTQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C(=N1)Br)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)