Products 2279124-40-0

CAS 2279124-40-0 is the registry number for Methyl 1-benzyl-5-bromo-1h-1,2,4-triazole-3-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1-benzyl-5-bromo-1,2,4-triazole-3-carboxylate (CAS 2279124-40-0) is a chemical compound with the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. IUPAC name: methyl 1-benzyl-5-bromo-1,2,4-triazole-3-carboxylate. InChIKey: YPTVHRTZSHUZTQ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10BrN3O2
Molecular weight296.12 g/mol
IUPAC namemethyl 1-benzyl-5-bromo-1,2,4-triazole-3-carboxylate
InChIKeyYPTVHRTZSHUZTQ-UHFFFAOYSA-N
SMILESCOC(=O)C1=NN(C(=N1)Br)CC2=CC=CC=C2

Computed by PubChem (NCBI)