CAS 13808-93-0 is the registry number for 4-bromo-3,5-dimethyl-1-(4-nitrophenyl)pyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
4-bromo-3,5-dimethyl-1-(4-nitrophenyl)pyrazole (CAS 13808-93-0) is a chemical compound with the molecular formula C11H10BrN3O2 and a molecular weight of 296.12 g/mol. IUPAC name: 4-bromo-3,5-dimethyl-1-(4-nitrophenyl)pyrazole. InChIKey: LBSGBNRINWZGAW-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O2 |
|---|---|
| Molecular weight | 296.12 g/mol |
| IUPAC name | 4-bromo-3,5-dimethyl-1-(4-nitrophenyl)pyrazole |
| InChIKey | LBSGBNRINWZGAW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=C(C=C2)[N+](=O)[O-])C)Br |
Computed by PubChem (NCBI)