Products 1177298-27-9

CAS 1177298-27-9 is the registry number for 1-Cyclohexyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

2-cyclohexylpyrazole-3-carboxylic acid (CAS 1177298-27-9) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-cyclohexylpyrazole-3-carboxylic acid. InChIKey: DOBQDIUNKOKZKL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O2
Molecular weight194.23 g/mol
IUPAC name2-cyclohexylpyrazole-3-carboxylic acid
InChIKeyDOBQDIUNKOKZKL-UHFFFAOYSA-N
SMILESC1CCC(CC1)N2C(=CC=N2)C(=O)O

Computed by PubChem (NCBI)