Products 1177315-89-7
CAS 1177315-89-7 is the registry number for L-Phenylalanine tert-Butyl Ester-d5. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10 mg, 5 mg, 1 mg.
Tert-butyl (2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoate (CAS 1177315-89-7) is a chemical compound with the molecular formula C13H19NO2 and a molecular weight of 226.33 g/mol. IUPAC name: tert-butyl (2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoate. InChIKey: QOISWWBTZMFUEL-MEKJEUOKSA-N.
| Molecular formula | C13H19NO2 |
|---|---|
| Molecular weight | 226.33 g/mol |
| IUPAC name | tert-butyl (2S)-2-amino-3-(2,3,4,5,6-pentadeuteriophenyl)propanoate |
| InChIKey | QOISWWBTZMFUEL-MEKJEUOKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C[C@@H](C(=O)OC(C)(C)C)N)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
L-Phenylalanine tert-Butyl Ester-d5