CAS 1177319-39-9 is the registry number for 2-(2,5-Dimethylphenyl)piperidine Oxalate. Offered by: TRC. Available pack sizes: 2,5g.
2-(2,5-dimethylphenyl)piperidine;oxalic acid (CAS 1177319-39-9) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: 2-(2,5-dimethylphenyl)piperidine;oxalic acid. InChIKey: RVIUNBCCFYOFRQ-UHFFFAOYSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | 2-(2,5-dimethylphenyl)piperidine;oxalic acid |
| InChIKey | RVIUNBCCFYOFRQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)C2CCCCN2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)