Products 1177340-06-5
CAS 1177340-06-5 is the registry number for 5-(Aminomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 10g, 1g.
5-(aminomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one;hydrochloride (CAS 1177340-06-5) is a chemical compound with the molecular formula C10H12ClFN2O2 and a molecular weight of 246.66 g/mol. IUPAC name: 5-(aminomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one;hydrochloride. InChIKey: UPDVYQLNJKCOMT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2O2 |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | 5-(aminomethyl)-3-(4-fluorophenyl)-1,3-oxazolidin-2-one;hydrochloride |
| InChIKey | UPDVYQLNJKCOMT-UHFFFAOYSA-N |
| SMILES | C1C(OC(=O)N1C2=CC=C(C=C2)F)CN.Cl |
Computed by PubChem (NCBI)