Products 1803608-47-0
CAS 1803608-47-0 is the registry number for Azetidin-3-yl N-(3-fluorophenyl)carbamate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Azetidin-3-yl N-(3-fluorophenyl)carbamate;hydrochloride (CAS 1803608-47-0) is a chemical compound with the molecular formula C10H12ClFN2O2 and a molecular weight of 246.66 g/mol. IUPAC name: azetidin-3-yl N-(3-fluorophenyl)carbamate;hydrochloride. InChIKey: DDJDFXBPLQRJLZ-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2O2 |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | azetidin-3-yl N-(3-fluorophenyl)carbamate;hydrochloride |
| InChIKey | DDJDFXBPLQRJLZ-UHFFFAOYSA-N |
| SMILES | C1C(CN1)OC(=O)NC2=CC(=CC=C2)F.Cl |
Computed by PubChem (NCBI)