CAS 2763160-59-2 is the registry number for 1-(4-Amino-6-chloro-5-fluoro-2-isopropoxypyridin-3-yl)ethan-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-amino-6-chloro-5-fluoro-2-propan-2-yloxy-3-pyridinyl)ethanone (CAS 2763160-59-2) is a chemical compound with the molecular formula C10H12ClFN2O2 and a molecular weight of 246.66 g/mol. IUPAC name: 1-(4-amino-6-chloro-5-fluoro-2-propan-2-yloxy-3-pyridinyl)ethanone. InChIKey: QEHDBOXWDWZYKV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2O2 |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | 1-(4-amino-6-chloro-5-fluoro-2-propan-2-yloxy-3-pyridinyl)ethanone |
| InChIKey | QEHDBOXWDWZYKV-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=NC(=C(C(=C1C(=O)C)N)F)Cl |
Computed by PubChem (NCBI)