CAS 2680848-42-2 is the registry number for tert-Butyl (2-chloro-4-fluoropyridin-3-yl)carbamate, 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl N-(2-chloro-4-fluoro-3-pyridinyl)carbamate (CAS 2680848-42-2) is a chemical compound with the molecular formula C10H12ClFN2O2 and a molecular weight of 246.66 g/mol. IUPAC name: tert-butyl N-(2-chloro-4-fluoro-3-pyridinyl)carbamate. InChIKey: RBLSPXSOUJPUIL-UHFFFAOYSA-N.
| Molecular formula | C10H12ClFN2O2 |
|---|---|
| Molecular weight | 246.66 g/mol |
| IUPAC name | tert-butyl N-(2-chloro-4-fluoro-3-pyridinyl)carbamate |
| InChIKey | RBLSPXSOUJPUIL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CN=C1Cl)F |
Computed by PubChem (NCBI)