CAS 1177354-53-8 is the registry number for (1-Aminocyclopentyl)methanol oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(1-aminocyclopentyl)methanol;oxalic acid (CAS 1177354-53-8) is a chemical compound with the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. IUPAC name: (1-aminocyclopentyl)methanol;oxalic acid. InChIKey: WFMQPLGGNDWPFY-UHFFFAOYSA-N.
| Molecular formula | C8H15NO5 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (1-aminocyclopentyl)methanol;oxalic acid |
| InChIKey | WFMQPLGGNDWPFY-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(CO)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)