CAS 52558-23-3 appears in our catalog under these names: (R)-Boc-Isoser-OH 95%, (R)-3-(Boc-amino)-2-hydroxypropanoic Acid, 95%+, 95%+. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 52558-23-3) is a chemical compound with the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. IUPAC name: (2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JJCAYTVAYSGVLA-RXMQYKEDSA-N.
| Molecular formula | C8H15NO5 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (2R)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JJCAYTVAYSGVLA-RXMQYKEDSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](C(=O)O)O |
Computed by PubChem (NCBI)