CAS 1187929-85-6 appears in our catalog under these names: 3-Isopropoxy-azetidine oxalate, 96%, 3-Isopropoxyazetidine oxalate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 5g, 1g, 250mg.
Oxalic acid;3-propan-2-yloxyazetidine (CAS 1187929-85-6) is a chemical compound with the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. IUPAC name: oxalic acid;3-propan-2-yloxyazetidine. InChIKey: RGFXZUWDICPDCC-UHFFFAOYSA-N.
| Molecular formula | C8H15NO5 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | oxalic acid;3-propan-2-yloxyazetidine |
| InChIKey | RGFXZUWDICPDCC-UHFFFAOYSA-N |
| SMILES | CC(C)OC1CNC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)