Products 625-03-6
CAS 625-03-6 appears in our catalog under these names: 4-Amino-4-methyl-2-pentanone oxalate, 90%, 4-Amino-4-methyl-2-pentanone oxalate, 98%, 4-Amino-4-methyl-2-pentanone oxalate, >95%, >95%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 5g, 1g, 25g, 100mg, 250mg, 10g, 100g.
4-amino-4-methylpentan-2-one;oxalic acid (CAS 625-03-6) is a chemical compound with the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. IUPAC name: 4-amino-4-methylpentan-2-one;oxalic acid. InChIKey: PABISXFQAHDPMS-UHFFFAOYSA-N.
| Molecular formula | C8H15NO5 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | 4-amino-4-methylpentan-2-one;oxalic acid |
| InChIKey | PABISXFQAHDPMS-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(C)(C)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
1,1-Dimethyl-3-oxobutylammonium hydrogen oxalate, 4-Amino-4-methyl-2-pentanone Oxalate, 4-amino-4-methylpentan-2-one;oxalic acid, Diacetonamine hydrogen oxalate, 4-amino-4-methyl-pentan-2-one; oxalic acid, Diacetonamine, hemioxalate, 4-Amino-4-methyl-2-pentanoneOxalate, DIACETONEAMINE HYDROGEN OXALATE, Diacetonamine, monooxalate, Diacetonamine hydrogenoxalate, 90%