CAS 1177558-41-6 is the registry number for 2-((3-Bromo-5-methylphenyl)methyl)-1H-isoindole-1,3(2H)-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-[(3-bromo-5-methylphenyl)methyl]isoindole-1,3-dione (CAS 1177558-41-6) is a chemical compound with the molecular formula C16H12BrNO2 and a molecular weight of 330.17 g/mol. IUPAC name: 2-[(3-bromo-5-methylphenyl)methyl]isoindole-1,3-dione. InChIKey: ASEHGKLOKZKILG-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO2 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-[(3-bromo-5-methylphenyl)methyl]isoindole-1,3-dione |
| InChIKey | ASEHGKLOKZKILG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Br)CN2C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)