CAS 2364584-78-9 appears in our catalog under these names: 5-(4-(Benzyloxy)-3-bromophenyl)oxazole, 95%, 5-(4-(Benzyloxy)-3-bromophenyl)oxazole. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 250mg, 1g.
5-(3-bromo-4-phenylmethoxyphenyl)-1,3-oxazole (CAS 2364584-78-9) is a chemical compound with the molecular formula C16H12BrNO2 and a molecular weight of 330.17 g/mol. IUPAC name: 5-(3-bromo-4-phenylmethoxyphenyl)-1,3-oxazole. InChIKey: KGIBTAMFSHHOIF-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO2 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 5-(3-bromo-4-phenylmethoxyphenyl)-1,3-oxazole |
| InChIKey | KGIBTAMFSHHOIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C3=CN=CO3)Br |
Computed by PubChem (NCBI)