CAS 124499-18-9 appears in our catalog under these names: 2-(4-Bromophenethyl)isoindoline-1,3-dione, 95%, N-(4-Bromopheneethyl-phthalimide, >95% (HPLC). Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 500mg.
2-[2-(4-bromophenyl)ethyl]isoindole-1,3-dione (CAS 124499-18-9) is a chemical compound with the molecular formula C16H12BrNO2 and a molecular weight of 330.17 g/mol. IUPAC name: 2-[2-(4-bromophenyl)ethyl]isoindole-1,3-dione. InChIKey: BHAQWVPXYIADCG-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO2 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-[2-(4-bromophenyl)ethyl]isoindole-1,3-dione |
| InChIKey | BHAQWVPXYIADCG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)