CAS 328002-46-6 is the registry number for 5-Bromo-1-(2-phenylethyl)-1h-indole-2,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-1-(2-phenylethyl)indole-2,3-dione (CAS 328002-46-6) is a chemical compound with the molecular formula C16H12BrNO2 and a molecular weight of 330.17 g/mol. IUPAC name: 5-bromo-1-(2-phenylethyl)indole-2,3-dione. InChIKey: XMGYGDOAQMLZAW-UHFFFAOYSA-N.
| Molecular formula | C16H12BrNO2 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 5-bromo-1-(2-phenylethyl)indole-2,3-dione |
| InChIKey | XMGYGDOAQMLZAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCN2C3=C(C=C(C=C3)Br)C(=O)C2=O |
Computed by PubChem (NCBI)