CAS 117811-12-8 appears in our catalog under these names: Desloratadine Impurity 43, 5-Hydroxy Desloratadine (Mixture of Isomers), 5-Hydroxy Desloratadine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 1mg.
13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-9-ol (CAS 117811-12-8) is a chemical compound with the molecular formula C19H19ClN2O and a molecular weight of 326.8 g/mol. IUPAC name: 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-9-ol. InChIKey: LWCSUGDLKORNAJ-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-9-ol |
| InChIKey | LWCSUGDLKORNAJ-UHFFFAOYSA-N |
| SMILES | C1CNCCC1=C2C3=C(CC(C4=C2N=CC=C4)O)C=C(C=C3)Cl |
Computed by PubChem (NCBI)