CAS 1193725-73-3 appears in our catalog under these names: Desloratadine n-hydroxypiperidine, 95%, Desloratadine N-Hydroxy Impurity, Desloratadine N-Hydroxypiperidine, Desloratadine Impurity 17, Desloratadine N-Hydroxypiperidine 95%. Offered by: Combi-blocks, Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: 200mg, on request, 10mg, 25mg, 50mg, 100mg, 0,1g, 250mg.
13-chloro-2-(1-hydroxypiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 1193725-73-3) is a chemical compound with the molecular formula C19H19ClN2O and a molecular weight of 326.8 g/mol. IUPAC name: 13-chloro-2-(1-hydroxypiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: AMIBINHLAUROKH-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 13-chloro-2-(1-hydroxypiperidin-4-ylidene)-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | AMIBINHLAUROKH-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCN(CC3)O)C4=C1C=CC=N4 |
Computed by PubChem (NCBI)