CAS 119410-05-8 appears in our catalog under these names: 6-Hydroxy Desloratadine (Mixture of Conformational Isomers), Desloratadine Impurity 42, Desloratadine Impurity 21, 6-Hydroxy Desloratadine. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-ol (CAS 119410-05-8) is a chemical compound with the molecular formula C19H19ClN2O and a molecular weight of 326.8 g/mol. IUPAC name: 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-ol. InChIKey: UEQNVDYYIWHWNX-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 13-chloro-2-piperidin-4-ylidene-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-10-ol |
| InChIKey | UEQNVDYYIWHWNX-UHFFFAOYSA-N |
| SMILES | C1CNCCC1=C2C3=C(C=C(C=C3)Cl)C(CC4=C2N=CC=C4)O |
Computed by PubChem (NCBI)