Products 169253-26-3
CAS 169253-26-3 appears in our catalog under these names: Desloratadine pyridine n-oxide, 95%, Desloratadine Pyridine N-Oxide, Desloratadine N-Oxide. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 100mg, on request, 2,5mg.
13-chloro-4-oxido-2-piperidin-4-ylidene-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (CAS 169253-26-3) is a chemical compound with the molecular formula C19H19ClN2O and a molecular weight of 326.8 g/mol. IUPAC name: 13-chloro-4-oxido-2-piperidin-4-ylidene-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene. InChIKey: ZTRQZDOHUHWANO-UHFFFAOYSA-N.
| Molecular formula | C19H19ClN2O |
|---|---|
| Molecular weight | 326.8 g/mol |
| IUPAC name | 13-chloro-4-oxido-2-piperidin-4-ylidene-4-azoniatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| InChIKey | ZTRQZDOHUHWANO-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)Cl)C(=C3CCNCC3)C4=C1C=CC=[N+]4[O-] |
Computed by PubChem (NCBI)