Products 117811-79-7
CAS 117811-79-7 is the registry number for Benzyl (2S,4R)-2-(hydroxymethyl)-4-((methylsulfonyl)oxy)pyrrolidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S,4R)-2-(hydroxymethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate (CAS 117811-79-7) is a chemical compound with the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. IUPAC name: benzyl (2S,4R)-2-(hydroxymethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate. InChIKey: QQGZOHNKVFKZOS-QWHCGFSZSA-N.
| Molecular formula | C14H19NO6S |
|---|---|
| Molecular weight | 329.37 g/mol |
| IUPAC name | benzyl (2S,4R)-2-(hydroxymethyl)-4-methylsulfonyloxypyrrolidine-1-carboxylate |
| InChIKey | QQGZOHNKVFKZOS-QWHCGFSZSA-N |
| SMILES | CS(=O)(=O)O[C@@H]1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)CO |
Computed by PubChem (NCBI)