CAS 593261-75-7 appears in our catalog under these names: 1-(3,4-Dimethoxybenzenesulfonyl)piperidine-4-carboxylic acid, 95%, 1-(3,4-Dimethoxybenzenesulfonyl)piperidine-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxylic acid (CAS 593261-75-7) is a chemical compound with the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxylic acid. InChIKey: OCVQQQOCYVCMFA-UHFFFAOYSA-N.
| Molecular formula | C14H19NO6S |
|---|---|
| Molecular weight | 329.37 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)sulfonylpiperidine-4-carboxylic acid |
| InChIKey | OCVQQQOCYVCMFA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)N2CCC(CC2)C(=O)O)OC |
Computed by PubChem (NCBI)