CAS 1418095-19-8 is the registry number for N-(2-Ethyl-6-methylphenyl)-N-(2-sulfoacetyl)-L-alanine. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
(2S)-2-(2-ethyl-6-methyl-N-(2-sulfoacetyl)anilino)propanoic acid (CAS 1418095-19-8) is a chemical compound with the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. IUPAC name: (2S)-2-(2-ethyl-6-methyl-N-(2-sulfoacetyl)anilino)propanoic acid. InChIKey: WOXWIWNBIJDJHI-JTQLQIEISA-N.
| Molecular formula | C14H19NO6S |
|---|---|
| Molecular weight | 329.37 g/mol |
| IUPAC name | (2S)-2-(2-ethyl-6-methyl-N-(2-sulfoacetyl)anilino)propanoic acid |
| InChIKey | WOXWIWNBIJDJHI-JTQLQIEISA-N |
| SMILES | CCC1=CC=CC(=C1N([C@@H](C)C(=O)O)C(=O)CS(=O)(=O)O)C |
Computed by PubChem (NCBI)