CAS 2222491-84-9 is the registry number for Rel-(1s,4s)-4-ethoxycyclohexyl 4-nitrobenzenesulfonate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-ethoxycyclohexyl) 4-nitrobenzenesulfonate (CAS 2222491-84-9) is a chemical compound with the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. IUPAC name: (4-ethoxycyclohexyl) 4-nitrobenzenesulfonate. InChIKey: ODNCSIZLKBQURO-UHFFFAOYSA-N.
| Molecular formula | C14H19NO6S |
|---|---|
| Molecular weight | 329.37 g/mol |
| IUPAC name | (4-ethoxycyclohexyl) 4-nitrobenzenesulfonate |
| InChIKey | ODNCSIZLKBQURO-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(CC1)OS(=O)(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)