CAS 117824-53-0 is the registry number for 2,4-Dibromo-6-methyl-3-nitroaniline, 99%. Offered by: Fluorochem. Available pack sizes: 100g.
2,4-dibromo-6-methyl-3-nitroaniline (CAS 117824-53-0) is a chemical compound with the molecular formula C7H6Br2N2O2 and a molecular weight of 309.94 g/mol. IUPAC name: 2,4-dibromo-6-methyl-3-nitroaniline. InChIKey: FXPFCDKCGCSKLO-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O2 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 2,4-dibromo-6-methyl-3-nitroaniline |
| InChIKey | FXPFCDKCGCSKLO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1N)Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)