CAS 1326310-78-4 appears in our catalog under these names: 4,6-Dibromo-3-methyl-2-nitroaniline, 95%, 4,6–Dibromo–3–methyl–2–nitroaniline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
4,6-dibromo-3-methyl-2-nitroaniline (CAS 1326310-78-4) is a chemical compound with the molecular formula C7H6Br2N2O2 and a molecular weight of 309.94 g/mol. IUPAC name: 4,6-dibromo-3-methyl-2-nitroaniline. InChIKey: SVRROOZRCWBWDP-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O2 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | 4,6-dibromo-3-methyl-2-nitroaniline |
| InChIKey | SVRROOZRCWBWDP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1Br)Br)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)