CAS 443956-21-6 appears in our catalog under these names: Methyl 6–amino–3,5–dibromopicolinate, Methyl 6-amino-3,5-dibromopicolinate 95%, Methyl 6-amino-3,5-dibromopicolinate, 98%, Methyl 6-Amino-3,5-dibromopyridine-2-carboxylate, Methyl 6-amino-3,5-dibromopicolinate, 95%, 95%. Offered by: GLPBio, Ambeed, Fluorochem, TRC, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g, 10g, 25g.
Methyl 6-amino-3,5-dibromopyridine-2-carboxylate (CAS 443956-21-6) is a chemical compound with the molecular formula C7H6Br2N2O2 and a molecular weight of 309.94 g/mol. IUPAC name: methyl 6-amino-3,5-dibromopyridine-2-carboxylate. InChIKey: RLNKFHZYSZFLTL-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O2 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | methyl 6-amino-3,5-dibromopyridine-2-carboxylate |
| InChIKey | RLNKFHZYSZFLTL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC(=C(C=C1Br)Br)N |
Computed by PubChem (NCBI)