CAS 2791314-19-5 is the registry number for N-(4,6-Dibromo-2-methoxypyridin-3-yl)formamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4,6-dibromo-2-methoxy-3-pyridinyl)formamide (CAS 2791314-19-5) is a chemical compound with the molecular formula C7H6Br2N2O2 and a molecular weight of 309.94 g/mol. IUPAC name: N-(4,6-dibromo-2-methoxy-3-pyridinyl)formamide. InChIKey: MNLJCOULYVAPIM-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2N2O2 |
|---|---|
| Molecular weight | 309.94 g/mol |
| IUPAC name | N-(4,6-dibromo-2-methoxy-3-pyridinyl)formamide |
| InChIKey | MNLJCOULYVAPIM-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=N1)Br)Br)NC=O |
Computed by PubChem (NCBI)