CAS 1178294-42-2 appears in our catalog under these names: 4-(2,2-Difluoroethanesulfonyl)benzoic acid, 95%, 4-(2,2-Difluoroethanesulfonyl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(2,2-difluoroethylsulfonyl)benzoic acid (CAS 1178294-42-2) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 4-(2,2-difluoroethylsulfonyl)benzoic acid. InChIKey: LVAOTYTZBUUXIH-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4S |
|---|---|
| Molecular weight | 250.22 g/mol |
| IUPAC name | 4-(2,2-difluoroethylsulfonyl)benzoic acid |
| InChIKey | LVAOTYTZBUUXIH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)S(=O)(=O)CC(F)F |
Computed by PubChem (NCBI)