CAS 1183969-59-6 is the registry number for 3-(2,2-Difluoroethanesulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,2-difluoroethylsulfonyl)benzoic acid (CAS 1183969-59-6) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 3-(2,2-difluoroethylsulfonyl)benzoic acid. InChIKey: PINZJDNWHFOLGE-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4S |
|---|---|
| Molecular weight | 250.22 g/mol |
| IUPAC name | 3-(2,2-difluoroethylsulfonyl)benzoic acid |
| InChIKey | PINZJDNWHFOLGE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)CC(F)F)C(=O)O |
Computed by PubChem (NCBI)