Products 1183969-59-6

CAS 1183969-59-6 is the registry number for 3-(2,2-Difluoroethanesulfonyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-(2,2-difluoroethylsulfonyl)benzoic acid (CAS 1183969-59-6) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 3-(2,2-difluoroethylsulfonyl)benzoic acid. InChIKey: PINZJDNWHFOLGE-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O4S
Molecular weight250.22 g/mol
IUPAC name3-(2,2-difluoroethylsulfonyl)benzoic acid
InChIKeyPINZJDNWHFOLGE-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)CC(F)F)C(=O)O

Computed by PubChem (NCBI)