CAS 2592405-68-8 is the registry number for 3-(Difluoromethyl)-5-(methylsulfonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(difluoromethyl)-5-methylsulfonylbenzoic acid (CAS 2592405-68-8) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 3-(difluoromethyl)-5-methylsulfonylbenzoic acid. InChIKey: WWFZUIJTNJYFKG-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4S |
|---|---|
| Molecular weight | 250.22 g/mol |
| IUPAC name | 3-(difluoromethyl)-5-methylsulfonylbenzoic acid |
| InChIKey | WWFZUIJTNJYFKG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=CC(=C1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)