Products 2592405-68-8

CAS 2592405-68-8 is the registry number for 3-(Difluoromethyl)-5-(methylsulfonyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(difluoromethyl)-5-methylsulfonylbenzoic acid (CAS 2592405-68-8) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 3-(difluoromethyl)-5-methylsulfonylbenzoic acid. InChIKey: WWFZUIJTNJYFKG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O4S
Molecular weight250.22 g/mol
IUPAC name3-(difluoromethyl)-5-methylsulfonylbenzoic acid
InChIKeyWWFZUIJTNJYFKG-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC(=CC(=C1)C(=O)O)C(F)F

Computed by PubChem (NCBI)