Products 1785171-44-9

CAS 1785171-44-9 is the registry number for 2,2-Difluoro-2-(4-(methylsulfonyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,2-difluoro-2-(4-methylsulfonylphenyl)acetic acid (CAS 1785171-44-9) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 2,2-difluoro-2-(4-methylsulfonylphenyl)acetic acid. InChIKey: XXJKEZYDMQUFAN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H8F2O4S
Molecular weight250.22 g/mol
IUPAC name2,2-difluoro-2-(4-methylsulfonylphenyl)acetic acid
InChIKeyXXJKEZYDMQUFAN-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CC=C(C=C1)C(C(=O)O)(F)F

Computed by PubChem (NCBI)