CAS 1785171-44-9 is the registry number for 2,2-Difluoro-2-(4-(methylsulfonyl)phenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-(4-methylsulfonylphenyl)acetic acid (CAS 1785171-44-9) is a chemical compound with the molecular formula C9H8F2O4S and a molecular weight of 250.22 g/mol. IUPAC name: 2,2-difluoro-2-(4-methylsulfonylphenyl)acetic acid. InChIKey: XXJKEZYDMQUFAN-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O4S |
|---|---|
| Molecular weight | 250.22 g/mol |
| IUPAC name | 2,2-difluoro-2-(4-methylsulfonylphenyl)acetic acid |
| InChIKey | XXJKEZYDMQUFAN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)