Products 1178492-52-8
CAS 1178492-52-8 is the registry number for 2-(5-Chloro-2-methoxyphenyl)propan-2-amine. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(5-chloro-2-methoxyphenyl)propan-2-amine (CAS 1178492-52-8) is a chemical compound with the molecular formula C10H14ClNO and a molecular weight of 199.68 g/mol. IUPAC name: 2-(5-chloro-2-methoxyphenyl)propan-2-amine. InChIKey: KCXOYONLPCYFJS-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO |
|---|---|
| Molecular weight | 199.68 g/mol |
| IUPAC name | 2-(5-chloro-2-methoxyphenyl)propan-2-amine |
| InChIKey | KCXOYONLPCYFJS-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=C(C=CC(=C1)Cl)OC)N |
Computed by PubChem (NCBI)