Products 1179134-61-2
CAS 1179134-61-2 appears in our catalog under these names: 3-((Pyrazin-2-ylamino)methyl)benzonitrile, 98%, 3-{((Pyrazin-2-yl)amino)methyl}benzonitrile. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
3-[(pyrazin-2-ylamino)methyl]benzonitrile (CAS 1179134-61-2) is a chemical compound with the molecular formula C12H10N4 and a molecular weight of 210.23 g/mol. IUPAC name: 3-[(pyrazin-2-ylamino)methyl]benzonitrile. InChIKey: QROVCMFTNIXVJR-UHFFFAOYSA-N.
| Molecular formula | C12H10N4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 3-[(pyrazin-2-ylamino)methyl]benzonitrile |
| InChIKey | QROVCMFTNIXVJR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C#N)CNC2=NC=CN=C2 |
Computed by PubChem (NCBI)