Products 1179178-28-9

CAS 1179178-28-9 is the registry number for Methyl 2-amino-3-ethylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-ethylbenzoate (CAS 1179178-28-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 2-amino-3-ethylbenzoate. InChIKey: ORMUAHXMMQWFQP-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC namemethyl 2-amino-3-ethylbenzoate
InChIKeyORMUAHXMMQWFQP-UHFFFAOYSA-N
SMILESCCC1=C(C(=CC=C1)C(=O)OC)N

Computed by PubChem (NCBI)