CAS 1179178-28-9 is the registry number for Methyl 2-amino-3-ethylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 2-amino-3-ethylbenzoate (CAS 1179178-28-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 2-amino-3-ethylbenzoate. InChIKey: ORMUAHXMMQWFQP-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 2-amino-3-ethylbenzoate |
| InChIKey | ORMUAHXMMQWFQP-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)C(=O)OC)N |
Computed by PubChem (NCBI)