Products 1179226-36-8
CAS 1179226-36-8 is the registry number for (3-Methoxyphenyl)(3-(trifluoromethyl)phenyl)methanol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g, 50g.
(3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methanol (CAS 1179226-36-8) is a chemical compound with the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. IUPAC name: (3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methanol. InChIKey: RRBISPKRAINESR-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O2 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | (3-methoxyphenyl)-[3-(trifluoromethyl)phenyl]methanol |
| InChIKey | RRBISPKRAINESR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C(C2=CC(=CC=C2)C(F)(F)F)O |
Computed by PubChem (NCBI)