CAS 1253188-22-5 appears in our catalog under these names: 4-Benzyloxy-2-(trifluoromethyl)benzayl alcohol, 95%, (4-(Benzyloxy)-2-(trifluoromethyl)phenyl)methanol, ≥95%, ≥95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 10g, 5g, 250mg, 1g.
[4-phenylmethoxy-2-(trifluoromethyl)phenyl]methanol (CAS 1253188-22-5) is a chemical compound with the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. IUPAC name: [4-phenylmethoxy-2-(trifluoromethyl)phenyl]methanol. InChIKey: PZUDYOVZXZBMBO-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O2 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | [4-phenylmethoxy-2-(trifluoromethyl)phenyl]methanol |
| InChIKey | PZUDYOVZXZBMBO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=C(C=C2)CO)C(F)(F)F |
Computed by PubChem (NCBI)