Products 1487001-79-5
CAS 1487001-79-5 is the registry number for α-Methyl-α-phenyl-3-(trifluoromethoxy)benzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-phenyl-1-[3-(trifluoromethoxy)phenyl]ethanol (CAS 1487001-79-5) is a chemical compound with the molecular formula C15H13F3O2 and a molecular weight of 282.26 g/mol. IUPAC name: 1-phenyl-1-[3-(trifluoromethoxy)phenyl]ethanol. InChIKey: NTRQWXFTRZFASM-UHFFFAOYSA-N.
| Molecular formula | C15H13F3O2 |
|---|---|
| Molecular weight | 282.26 g/mol |
| IUPAC name | 1-phenyl-1-[3-(trifluoromethoxy)phenyl]ethanol |
| InChIKey | NTRQWXFTRZFASM-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)(C2=CC(=CC=C2)OC(F)(F)F)O |
Computed by PubChem (NCBI)